C22H13Cl2FN2O4S — CID 1333952
2-[5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 1333952) has the molecular formula C22H13Cl2FN2O4S and a molecular weight of 491.33 g/mol. Its IUPAC name is 2-[5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 1333952 |
| Molecular Formula | C22H13Cl2FN2O4S |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | 2-[5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)SC(=Cc2ccc(-c3ccc(Cl)cc3Cl)o2)C1=O)Nc1ccccc1F |
| InChI | InChI=1S/C22H13Cl2FN2O4S/c23-12-5-7-14(15(24)9-12)18-8-6-13(31-18)10-19-21(29)27(22(30)32-19)11-20(28)26-17-4-2-1-3-16(17)25/h1-10H,11H2,(H,26,28) |
| InChIKey | CPRAYFHHYLVQNR-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|