C23H13ClF2N2O6S — CID 126281829
4-chloro-3-[5-[(Z)-[3-[2-(2,4-difluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 126281829) has the molecular formula C23H13ClF2N2O6S and a molecular weight of 518.88 g/mol. Its IUPAC name is 4-chloro-3-[5-[(Z)-[3-[2-(2,4-difluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-chloro-3-[5-[(Z)-[3-[2-(2,4-difluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126281829 |
| Molecular Formula | C23H13ClF2N2O6S |
| Molecular Weight | 518.88 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | 4-chloro-3-[5-[(Z)-[3-[2-(2,4-difluoroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(-c3cc(C(=O)O)ccc3Cl)o2)C1=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C23H13ClF2N2O6S/c24-15-4-1-11(22(31)32)7-14(15)18-6-3-13(34-18)9-19-21(30)28(23(33)35-19)10-20(29)27-17-5-2-12(25)8-16(17)26/h1-9H,10H2,(H,27,29)(H,31,32)/b19-9- |
| InChIKey | LCSGBUDGUHGMIX-OCKHKDLRSA-N |
| XLogP | 5.25 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.88 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|