C18H10ClNO5S — CID 1333758
4-chloro-3-[5-[(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 1333758) has the molecular formula C18H10ClNO5S and a molecular weight of 387.80 g/mol. Its IUPAC name is 4-chloro-3-[5-[(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-chloro-3-[5-[(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 1333758 |
| Molecular Formula | C18H10ClNO5S |
| Molecular Weight | 387.80 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 4-chloro-3-[5-[(2,4-dioxo-3-prop-2-ynyl-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | C#CCN1C(=O)SC(=Cc2ccc(-c3cc(C(=O)O)ccc3Cl)o2)C1=O |
| InChI | InChI=1S/C18H10ClNO5S/c1-2-7-20-16(21)15(26-18(20)24)9-11-4-6-14(25-11)12-8-10(17(22)23)3-5-13(12)19/h1,3-6,8-9H,7H2,(H,22,23) |
| InChIKey | BFEDZBITJOETJI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.80 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|