C22H13F2N3O6S — CID 4006586
N-(2,4-difluorophenyl)-2-[5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 4006586) has the molecular formula C22H13F2N3O6S and a molecular weight of 485.42 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 4006586 |
| Molecular Formula | C22H13F2N3O6S |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)SC(=Cc2ccc(-c3ccccc3[N+](=O)[O-])o2)C1=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C22H13F2N3O6S/c23-12-5-7-16(15(24)9-12)25-20(28)11-26-21(29)19(34-22(26)30)10-13-6-8-18(33-13)14-3-1-2-4-17(14)27(31)32/h1-10H,11H2,(H,25,28) |
| InChIKey | PNRUCZTUVWKPOD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|