C22H12F3N3O6S — CID 126277774
2-[(5E)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 126277774) has the molecular formula C22H12F3N3O6S and a molecular weight of 503.41 g/mol. Its IUPAC name is 2-[(5E)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 126277774 |
| Molecular Formula | C22H12F3N3O6S |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | 2-[(5E)-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(-c3ccccc3[N+](=O)[O-])o2)C1=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C22H12F3N3O6S/c23-13-6-7-14(20(25)19(13)24)26-18(29)10-27-21(30)17(35-22(27)31)9-11-5-8-16(34-11)12-3-1-2-4-15(12)28(32)33/h1-9H,10H2,(H,26,29)/b17-9+ |
| InChIKey | KNNXVTLGONKNSZ-RQZCQDPDSA-N |
| XLogP | 4.95 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|