C18H10F3N3O5S — CID 126347019
2-[(5E)-5-[(3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 126347019) has the molecular formula C18H10F3N3O5S and a molecular weight of 437.36 g/mol. Its IUPAC name is 2-[(5E)-5-[(3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 126347019 |
| Molecular Formula | C18H10F3N3O5S |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | 2-[(5E)-5-[(3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cccc([N+](=O)[O-])c2)C1=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H10F3N3O5S/c19-11-4-5-12(16(21)15(11)20)22-14(25)8-23-17(26)13(30-18(23)27)7-9-2-1-3-10(6-9)24(28)29/h1-7H,8H2,(H,22,25)/b13-7+ |
| InChIKey | CDYJHDARPOHLRY-NTUHNPAUSA-N |
| XLogP | 3.69 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|