C19H10F3N3O3S — CID 126347724
2-[(5E)-5-[(4-cyanophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 126347724) has the molecular formula C19H10F3N3O3S and a molecular weight of 417.37 g/mol. Its IUPAC name is 2-[(5E)-5-[(4-cyanophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(4-cyanophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 126347724 |
| Molecular Formula | C19H10F3N3O3S |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 2-[(5E)-5-[(4-cyanophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | N#Cc1ccc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(F)c(F)c3F)C2=O)cc1 |
| InChI | InChI=1S/C19H10F3N3O3S/c20-12-5-6-13(17(22)16(12)21)24-15(26)9-25-18(27)14(29-19(25)28)7-10-1-3-11(8-23)4-2-10/h1-7H,9H2,(H,24,26)/b14-7+ |
| InChIKey | FGKFNIQQHNPNNC-VGOFMYFVSA-N |
| XLogP | 3.65 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|