C19H12F3N3O5S — CID 1285868
2-[(5E)-5-[(3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 1285868) has the molecular formula C19H12F3N3O5S and a molecular weight of 451.38 g/mol. Its IUPAC name is 2-[(5E)-5-[(3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(5E)-5-[(3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 1285868 |
| Molecular Formula | C19H12F3N3O5S |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 2-[(5E)-5-[(3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cccc([N+](=O)[O-])c2)C1=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H12F3N3O5S/c20-19(21,22)12-4-2-5-13(9-12)23-16(26)10-24-17(27)15(31-18(24)28)8-11-3-1-6-14(7-11)25(29)30/h1-9H,10H2,(H,23,26)/b15-8+ |
| InChIKey | TVSRJVLEBNDNST-OVCLIPMQSA-N |
| XLogP | 4.29 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|