C26H17BrF3N3O6S — CID 126169903
2-[(5E)-5-[[3-bromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylphenyl)acetamide (PubChem CID 126169903) has the molecular formula C26H17BrF3N3O6S and a molecular weight of 636.40 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-bromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3-bromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126169903 |
| Molecular Formula | C26H17BrF3N3O6S |
| Molecular Weight | 636.40 g/mol |
| Exact Mass | 635.00 |
| IUPAC Name | 2-[(5E)-5-[[3-bromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)S/C(=C/c3ccc(Oc4ccc(C(F)(F)F)cc4[N+](=O)[O-])c(Br)c3)C2=O)c1 |
| InChI | InChI=1S/C26H17BrF3N3O6S/c1-14-3-2-4-17(9-14)31-23(34)13-32-24(35)22(40-25(32)36)11-15-5-7-20(18(27)10-15)39-21-8-6-16(26(28,29)30)12-19(21)33(37)38/h2-12H,13H2,1H3,(H,31,34)/b22-11+ |
| InChIKey | VEMKVAMSHVJVFR-SSDVNMTOSA-N |
| XLogP | 7.15 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.40 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|