C27H19BrF3N3O6S — CID 126184058
2-[(5E)-5-[[5-bromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 126184058) has the molecular formula C27H19BrF3N3O6S and a molecular weight of 650.43 g/mol. Its IUPAC name is 2-[(5E)-5-[[5-bromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[5-bromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126184058 |
| Molecular Formula | C27H19BrF3N3O6S |
| Molecular Weight | 650.43 g/mol |
| Exact Mass | 649.01 |
| IUPAC Name | 2-[(5E)-5-[[5-bromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)S/C(=C/c3cc(Br)ccc3Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])C2=O)c(C)c1 |
| InChI | InChI=1S/C27H19BrF3N3O6S/c1-14-3-6-19(15(2)9-14)32-24(35)13-33-25(36)23(41-26(33)37)11-16-10-18(28)5-8-21(16)40-22-7-4-17(27(29,30)31)12-20(22)34(38)39/h3-12H,13H2,1-2H3,(H,32,35)/b23-11+ |
| InChIKey | IORBVBZBRFRBHB-FOKLQQMPSA-N |
| XLogP | 7.46 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.43 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|