C26H18F3N3O6S — CID 126164112
N-(3-methylphenyl)-2-[(5E)-5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126164112) has the molecular formula C26H18F3N3O6S and a molecular weight of 557.51 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[(5E)-5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-methylphenyl)-2-[(5E)-5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126164112 |
| Molecular Formula | C26H18F3N3O6S |
| Molecular Weight | 557.51 g/mol |
| Exact Mass | 557.09 |
| IUPAC Name | N-(3-methylphenyl)-2-[(5E)-5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)S/C(=C/c3ccccc3Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])C2=O)c1 |
| InChI | InChI=1S/C26H18F3N3O6S/c1-15-5-4-7-18(11-15)30-23(33)14-31-24(34)22(39-25(31)35)12-16-6-2-3-8-20(16)38-21-10-9-17(26(27,28)29)13-19(21)32(36)37/h2-13H,14H2,1H3,(H,30,33)/b22-12+ |
| InChIKey | RYSQIBZBWMNCSR-WSDLNYQXSA-N |
| XLogP | 6.39 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.51 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|