C25H15F4N3O6S — CID 126249887
N-(3-fluorophenyl)-2-[(5E)-5-[[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126249887) has the molecular formula C25H15F4N3O6S and a molecular weight of 561.47 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[(5E)-5-[[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[(5E)-5-[[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126249887 |
| Molecular Formula | C25H15F4N3O6S |
| Molecular Weight | 561.47 g/mol |
| Exact Mass | 561.06 |
| IUPAC Name | N-(3-fluorophenyl)-2-[(5E)-5-[[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])cc2)C1=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C25H15F4N3O6S/c26-16-2-1-3-17(12-16)30-22(33)13-31-23(34)21(39-24(31)35)10-14-4-7-18(8-5-14)38-20-9-6-15(25(27,28)29)11-19(20)32(36)37/h1-12H,13H2,(H,30,33)/b21-10+ |
| InChIKey | ZRMXKBWFOJZSBA-UFFVCSGVSA-N |
| XLogP | 6.22 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.47 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|