C27H20F3N3O6S — CID 126165025
N-(3,4-dimethylphenyl)-2-[(5E)-5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126165025) has the molecular formula C27H20F3N3O6S and a molecular weight of 571.53 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[(5E)-5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[(5E)-5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126165025 |
| Molecular Formula | C27H20F3N3O6S |
| Molecular Weight | 571.53 g/mol |
| Exact Mass | 571.10 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[(5E)-5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)S/C(=C/c3ccccc3Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])C2=O)cc1C |
| InChI | InChI=1S/C27H20F3N3O6S/c1-15-7-9-19(11-16(15)2)31-24(34)14-32-25(35)23(40-26(32)36)12-17-5-3-4-6-21(17)39-22-10-8-18(27(28,29)30)13-20(22)33(37)38/h3-13H,14H2,1-2H3,(H,31,34)/b23-12+ |
| InChIKey | LLHDJNQBSJLOBU-FSJBWODESA-N |
| XLogP | 6.70 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.53 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|