C29H18F3N3O6S — CID 126279728
N-naphthalen-1-yl-2-[(5E)-5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126279728) has the molecular formula C29H18F3N3O6S and a molecular weight of 593.54 g/mol. Its IUPAC name is N-naphthalen-1-yl-2-[(5E)-5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-naphthalen-1-yl-2-[(5E)-5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126279728 |
| Molecular Formula | C29H18F3N3O6S |
| Molecular Weight | 593.54 g/mol |
| Exact Mass | 593.09 |
| IUPAC Name | N-naphthalen-1-yl-2-[(5E)-5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccccc2Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])C1=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C29H18F3N3O6S/c30-29(31,32)19-12-13-24(22(15-19)35(39)40)41-23-11-4-2-7-18(23)14-25-27(37)34(28(38)42-25)16-26(36)33-21-10-5-8-17-6-1-3-9-20(17)21/h1-15H,16H2,(H,33,36)/b25-14+ |
| InChIKey | JXXNLHUWGVJVMF-AFUMVMLFSA-N |
| XLogP | 7.23 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.54 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|