C31H22F3N3O7S — CID 126272743
2-[(5E)-5-[[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide (PubChem CID 126272743) has the molecular formula C31H22F3N3O7S and a molecular weight of 637.59 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(5E)-5-[[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 126272743 |
| Molecular Formula | C31H22F3N3O7S |
| Molecular Weight | 637.59 g/mol |
| Exact Mass | 637.11 |
| IUPAC Name | 2-[(5E)-5-[[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3cccc4ccccc34)C2=O)ccc1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H22F3N3O7S/c1-2-43-26-14-18(10-12-25(26)44-24-13-11-20(31(32,33)34)16-23(24)37(41)42)15-27-29(39)36(30(40)45-27)17-28(38)35-22-9-5-7-19-6-3-4-8-21(19)22/h3-16H,2,17H2,1H3,(H,35,38)/b27-15+ |
| InChIKey | PVVPEPVBRAERFY-JFLMPSFJSA-N |
| XLogP | 7.63 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.59 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|