C26H23ClN2O5S — CID 126280164
2-[(5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide (PubChem CID 126280164) has the molecular formula C26H23ClN2O5S and a molecular weight of 511.00 g/mol. Its IUPAC name is 2-[(5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 126280164 |
| Molecular Formula | C26H23ClN2O5S |
| Molecular Weight | 511.00 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 2-[(5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3cccc4ccccc34)C2=O)cc(Cl)c1OCC |
| InChI | InChI=1S/C26H23ClN2O5S/c1-3-33-21-13-16(12-19(27)24(21)34-4-2)14-22-25(31)29(26(32)35-22)15-23(30)28-20-11-7-9-17-8-5-6-10-18(17)20/h5-14H,3-4,15H2,1-2H3,(H,28,30)/b22-14+ |
| InChIKey | BHJGJGNFURRNET-HYARGMPZSA-N |
| XLogP | 5.97 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.00 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|