C22H20BrClN2O5S — CID 126339656
N-(2-bromophenyl)-2-[(5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126339656) has the molecular formula C22H20BrClN2O5S and a molecular weight of 539.84 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[(5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[(5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126339656 |
| Molecular Formula | C22H20BrClN2O5S |
| Molecular Weight | 539.84 g/mol |
| Exact Mass | 538.00 |
| IUPAC Name | N-(2-bromophenyl)-2-[(5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccccc3Br)C2=O)cc(Cl)c1OCC |
| InChI | InChI=1S/C22H20BrClN2O5S/c1-3-30-17-10-13(9-15(24)20(17)31-4-2)11-18-21(28)26(22(29)32-18)12-19(27)25-16-8-6-5-7-14(16)23/h5-11H,3-4,12H2,1-2H3,(H,25,27)/b18-11+ |
| InChIKey | UFWDXLUJFZMZHW-WOJGMQOQSA-N |
| XLogP | 5.57 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.84 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|