C22H17F3N2O8S — CID 73059003
ethyl 2-[5-[[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 73059003) has the molecular formula C22H17F3N2O8S and a molecular weight of 526.45 g/mol. Its IUPAC name is ethyl 2-[5-[[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[5-[[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 73059003 |
| Molecular Formula | C22H17F3N2O8S |
| Molecular Weight | 526.45 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | ethyl 2-[5-[[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)SC(=Cc2ccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(OC)c2)C1=O |
| InChI | InChI=1S/C22H17F3N2O8S/c1-3-34-19(28)11-26-20(29)18(36-21(26)30)9-12-4-6-16(17(8-12)33-2)35-15-7-5-13(22(23,24)25)10-14(15)27(31)32/h4-10H,3,11H2,1-2H3 |
| InChIKey | IPWCZMCDXYILBT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|