C23H19F3N2O7S — CID 126213797
[(2R)-butan-2-yl] 2-[(5E)-5-[[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126213797) has the molecular formula C23H19F3N2O7S and a molecular weight of 524.47 g/mol. Its IUPAC name is [(2R)-butan-2-yl] 2-[(5E)-5-[[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | [(2R)-butan-2-yl] 2-[(5E)-5-[[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126213797 |
| Molecular Formula | C23H19F3N2O7S |
| Molecular Weight | 524.47 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | [(2R)-butan-2-yl] 2-[(5E)-5-[[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC[C@@H](C)OC(=O)CN1C(=O)S/C(=C/c2cccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C23H19F3N2O7S/c1-3-13(2)34-20(29)12-27-21(30)19(36-22(27)31)10-14-5-4-6-16(9-14)35-18-8-7-15(23(24,25)26)11-17(18)28(32)33/h4-11,13H,3,12H2,1-2H3/b19-10+/t13-/m1/s1 |
| InChIKey | YACYEULMEXVQLG-BUESGFEBSA-N |
| XLogP | 5.78 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|