C23H18BrF3N2O7S — CID 126204857
2-methylpropyl 2-[(5E)-5-[[3-bromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126204857) has the molecular formula C23H18BrF3N2O7S and a molecular weight of 603.37 g/mol. Its IUPAC name is 2-methylpropyl 2-[(5E)-5-[[3-bromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-methylpropyl 2-[(5E)-5-[[3-bromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126204857 |
| Molecular Formula | C23H18BrF3N2O7S |
| Molecular Weight | 603.37 g/mol |
| Exact Mass | 602.00 |
| IUPAC Name | 2-methylpropyl 2-[(5E)-5-[[3-bromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC(C)COC(=O)CN1C(=O)S/C(=C/c2ccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(Br)c2)C1=O |
| InChI | InChI=1S/C23H18BrF3N2O7S/c1-12(2)11-35-20(30)10-28-21(31)19(37-22(28)32)8-13-3-5-17(15(24)7-13)36-18-6-4-14(23(25,26)27)9-16(18)29(33)34/h3-9,12H,10-11H2,1-2H3/b19-8+ |
| InChIKey | IWDQOHNYNDRPNM-UFWORHAWSA-N |
| XLogP | 6.40 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.37 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|