C29H22BrF3N4O6S — CID 126210186
(5E)-5-[[3-bromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126210186) has the molecular formula C29H22BrF3N4O6S and a molecular weight of 691.48 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-bromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126210186 |
| Molecular Formula | C29H22BrF3N4O6S |
| Molecular Weight | 691.48 g/mol |
| Exact Mass | 690.04 |
| IUPAC Name | (5E)-5-[[3-bromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(Br)c2)C1=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C29H22BrF3N4O6S/c30-21-14-18(6-8-23(21)43-24-9-7-19(29(31,32)33)16-22(24)37(41)42)15-25-27(39)36(28(40)44-25)17-26(38)35-12-10-34(11-13-35)20-4-2-1-3-5-20/h1-9,14-16H,10-13,17H2/b25-15+ |
| InChIKey | AHQOAWBCVHGYOM-MFKUBSTISA-N |
| XLogP | 6.55 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.48 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|