C28H20F3N3O9S — CID 126158178
N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126158178) has the molecular formula C28H20F3N3O9S and a molecular weight of 631.54 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126158178 |
| Molecular Formula | C28H20F3N3O9S |
| Molecular Weight | 631.54 g/mol |
| Exact Mass | 631.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(5E)-5-[[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc4c(c3)OCO4)C2=O)ccc1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H20F3N3O9S/c1-2-40-22-9-15(3-6-21(22)43-19-7-4-16(28(29,30)31)11-18(19)34(38)39)10-24-26(36)33(27(37)44-24)13-25(35)32-17-5-8-20-23(12-17)42-14-41-20/h3-12H,2,13-14H2,1H3,(H,32,35)/b24-10+ |
| InChIKey | IMJYSFFWNPZEDI-YSURURNPSA-N |
| XLogP | 6.21 |
| TPSA | 146.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|