C24H13Cl2F3N2O5S — CID 124666080
(5E)-3-[(3,4-dichlorophenyl)methyl]-5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124666080) has the molecular formula C24H13Cl2F3N2O5S and a molecular weight of 569.34 g/mol. Its IUPAC name is (5E)-3-[(3,4-dichlorophenyl)methyl]-5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(3,4-dichlorophenyl)methyl]-5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124666080 |
| Molecular Formula | C24H13Cl2F3N2O5S |
| Molecular Weight | 569.34 g/mol |
| Exact Mass | 567.99 |
| IUPAC Name | (5E)-3-[(3,4-dichlorophenyl)methyl]-5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccccc2Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])C(=O)N1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H13Cl2F3N2O5S/c25-16-7-5-13(9-17(16)26)12-30-22(32)21(37-23(30)33)10-14-3-1-2-4-19(14)36-20-8-6-15(24(27,28)29)11-18(20)31(34)35/h1-11H,12H2/b21-10+ |
| InChIKey | BEIWCGHJJDPGBS-UFFVCSGVSA-N |
| XLogP | 7.95 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.34 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|