C18H13N3O7S — CID 126368590
(5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-3-ethyl-1,3-thiazolidine-2,4-dione (PubChem CID 126368590) has the molecular formula C18H13N3O7S and a molecular weight of 415.38 g/mol. Its IUPAC name is (5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-3-ethyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-3-ethyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126368590 |
| Molecular Formula | C18H13N3O7S |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | (5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-3-ethyl-1,3-thiazolidine-2,4-dione |
| SMILES | CCN1C(=O)S/C(=C/c2ccccc2Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C18H13N3O7S/c1-2-19-17(22)16(29-18(19)23)9-11-5-3-4-6-14(11)28-15-8-7-12(20(24)25)10-13(15)21(26)27/h3-10H,2H2,1H3/b16-9+ |
| InChIKey | ISIPJAISAJEZBA-CXUHLZMHSA-N |
| XLogP | 4.35 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|