C23H15N3O8S — CID 126358688
(5Z)-5-[[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione (PubChem CID 126358688) has the molecular formula C23H15N3O8S and a molecular weight of 493.45 g/mol. Its IUPAC name is (5Z)-5-[[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126358688 |
| Molecular Formula | C23H15N3O8S |
| Molecular Weight | 493.45 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | (5Z)-5-[[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cccc(/C=C2\SC(=O)N(c3ccccc3)C2=O)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H15N3O8S/c1-33-19-9-5-6-14(12-20-22(27)24(23(28)35-20)15-7-3-2-4-8-15)21(19)34-18-11-10-16(25(29)30)13-17(18)26(31)32/h2-13H,1H3/b20-12- |
| InChIKey | GFONKIHAOYKKMQ-NDENLUEZSA-N |
| XLogP | 5.54 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|