C23H13ClFN3O7S2 — CID 126181468
(5E)-3-(3-chloro-4-fluorophenyl)-5-[[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126181468) has the molecular formula C23H13ClFN3O7S2 and a molecular weight of 561.96 g/mol. Its IUPAC name is (5E)-3-(3-chloro-4-fluorophenyl)-5-[[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(3-chloro-4-fluorophenyl)-5-[[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126181468 |
| Molecular Formula | C23H13ClFN3O7S2 |
| Molecular Weight | 561.96 g/mol |
| Exact Mass | 560.99 |
| IUPAC Name | (5E)-3-(3-chloro-4-fluorophenyl)-5-[[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cccc(/C=C2/SC(=S)N(c3ccc(F)c(Cl)c3)C2=O)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H13ClFN3O7S2/c1-34-19-4-2-3-12(21(19)35-18-8-6-14(27(30)31)11-17(18)28(32)33)9-20-22(29)26(23(36)37-20)13-5-7-16(25)15(24)10-13/h2-11H,1H3/b20-9+ |
| InChIKey | XCBAXZVBALVOOB-AWQFTUOYSA-N |
| XLogP | 6.50 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.96 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|