C26H20N4O9S — CID 126176809
2-[(5E)-5-[[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide (PubChem CID 126176809) has the molecular formula C26H20N4O9S and a molecular weight of 564.53 g/mol. Its IUPAC name is 2-[(5E)-5-[[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126176809 |
| Molecular Formula | C26H20N4O9S |
| Molecular Weight | 564.53 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | 2-[(5E)-5-[[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide |
| SMILES | COc1cccc(/C=C2/SC(=O)N(CC(=O)Nc3ccccc3C)C2=O)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H20N4O9S/c1-15-6-3-4-8-18(15)27-23(31)14-28-25(32)22(40-26(28)33)12-16-7-5-9-21(38-2)24(16)39-20-11-10-17(29(34)35)13-19(20)30(36)37/h3-13H,14H2,1-2H3,(H,27,31)/b22-12+ |
| InChIKey | WEPJBPHODZXVOI-WSDLNYQXSA-N |
| XLogP | 5.29 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|