C26H17ClN4O10S — CID 126160386
methyl 2-chloro-5-[[2-[(5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126160386) has the molecular formula C26H17ClN4O10S and a molecular weight of 612.96 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-[(5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-[(5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126160386 |
| Molecular Formula | C26H17ClN4O10S |
| Molecular Weight | 612.96 g/mol |
| Exact Mass | 612.04 |
| IUPAC Name | methyl 2-chloro-5-[[2-[(5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccccc3Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])C2=O)ccc1Cl |
| InChI | InChI=1S/C26H17ClN4O10S/c1-40-25(34)17-11-15(6-8-18(17)27)28-23(32)13-29-24(33)22(42-26(29)35)10-14-4-2-3-5-20(14)41-21-9-7-16(30(36)37)12-19(21)31(38)39/h2-12H,13H2,1H3,(H,28,32)/b22-10+ |
| InChIKey | JSIWBYFCIYNJND-LSHDLFTRSA-N |
| XLogP | 5.41 |
| TPSA | 188.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.96 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|