C20H14ClFN2O5S — CID 126167480
methyl 2-chloro-5-[[2-[(5E)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126167480) has the molecular formula C20H14ClFN2O5S and a molecular weight of 448.86 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-[(5E)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-[(5E)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126167480 |
| Molecular Formula | C20H14ClFN2O5S |
| Molecular Weight | 448.86 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | methyl 2-chloro-5-[[2-[(5E)-5-[(2-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccccc3F)C2=O)ccc1Cl |
| InChI | InChI=1S/C20H14ClFN2O5S/c1-29-19(27)13-9-12(6-7-14(13)21)23-17(25)10-24-18(26)16(30-20(24)28)8-11-4-2-3-5-15(11)22/h2-9H,10H2,1H3,(H,23,25)/b16-8+ |
| InChIKey | ZEYIIZNRDSRZSD-LZYBPNLTSA-N |
| XLogP | 3.94 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.86 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|