C31H23ClN2O6S — CID 126180418
methyl 2-chloro-5-[[2-[(5Z)-5-[[2-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126180418) has the molecular formula C31H23ClN2O6S and a molecular weight of 587.05 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-[(5Z)-5-[[2-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-[(5Z)-5-[[2-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126180418 |
| Molecular Formula | C31H23ClN2O6S |
| Molecular Weight | 587.05 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | methyl 2-chloro-5-[[2-[(5Z)-5-[[2-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3ccccc3OCc3ccc4ccccc4c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C31H23ClN2O6S/c1-39-30(37)24-16-23(12-13-25(24)32)33-28(35)17-34-29(36)27(41-31(34)38)15-22-8-4-5-9-26(22)40-18-19-10-11-20-6-2-3-7-21(20)14-19/h2-16H,17-18H2,1H3,(H,33,35)/b27-15- |
| InChIKey | SHQBRBDXHLQYRV-DICXZTSXSA-N |
| XLogP | 6.53 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.05 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|