C30H24N2O4S — CID 126172015
N-(4-methylphenyl)-2-[(5Z)-5-[[2-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126172015) has the molecular formula C30H24N2O4S and a molecular weight of 508.60 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[(5Z)-5-[[2-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[(5Z)-5-[[2-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126172015 |
| Molecular Formula | C30H24N2O4S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | N-(4-methylphenyl)-2-[(5Z)-5-[[2-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)S/C(=C\c3ccccc3OCc3ccc4ccccc4c3)C2=O)cc1 |
| InChI | InChI=1S/C30H24N2O4S/c1-20-10-14-25(15-11-20)31-28(33)18-32-29(34)27(37-30(32)35)17-24-8-4-5-9-26(24)36-19-21-12-13-22-6-2-3-7-23(22)16-21/h2-17H,18-19H2,1H3,(H,31,33)/b27-17- |
| InChIKey | BARYUEMTHOEHSF-PKAZHMFMSA-N |
| XLogP | 6.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|