C28H21NO6S — CID 3671420
methyl 5-[[5-[[2-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 3671420) has the molecular formula C28H21NO6S and a molecular weight of 499.54 g/mol. Its IUPAC name is methyl 5-[[5-[[2-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[5-[[2-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 3671420 |
| Molecular Formula | C28H21NO6S |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | methyl 5-[[5-[[2-(naphthalen-2-ylmethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)SC(=Cc3ccccc3OCc3ccc4ccccc4c3)C2=O)o1 |
| InChI | InChI=1S/C28H21NO6S/c1-33-27(31)24-13-12-22(35-24)16-29-26(30)25(36-28(29)32)15-21-8-4-5-9-23(21)34-17-18-10-11-19-6-2-3-7-20(19)14-18/h2-15H,16-17H2,1H3 |
| InChIKey | NKGJPKRJFBYINF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|