C21H20BrNO7S — CID 126392494
methyl 5-[[(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 126392494) has the molecular formula C21H20BrNO7S and a molecular weight of 510.36 g/mol. Its IUPAC name is methyl 5-[[(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126392494 |
| Molecular Formula | C21H20BrNO7S |
| Molecular Weight | 510.36 g/mol |
| Exact Mass | 509.01 |
| IUPAC Name | methyl 5-[[(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | CCOc1cc(OCC)c(/C=C2/SC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)cc1Br |
| InChI | InChI=1S/C21H20BrNO7S/c1-4-28-16-10-17(29-5-2)14(22)8-12(16)9-18-19(24)23(21(26)31-18)11-13-6-7-15(30-13)20(25)27-3/h6-10H,4-5,11H2,1-3H3/b18-9+ |
| InChIKey | YYADYLCZMVWYTF-GIJQJNRQSA-N |
| XLogP | 4.86 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.36 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|