C17H12BrNO6S — CID 5152749
methyl 5-[[5-[(5-bromo-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 5152749) has the molecular formula C17H12BrNO6S and a molecular weight of 438.26 g/mol. Its IUPAC name is methyl 5-[[5-[(5-bromo-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[5-[(5-bromo-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 5152749 |
| Molecular Formula | C17H12BrNO6S |
| Molecular Weight | 438.26 g/mol |
| Exact Mass | 436.96 |
| IUPAC Name | methyl 5-[[5-[(5-bromo-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)SC(=Cc3cc(Br)ccc3O)C2=O)o1 |
| InChI | InChI=1S/C17H12BrNO6S/c1-24-16(22)13-5-3-11(25-13)8-19-15(21)14(26-17(19)23)7-9-6-10(18)2-4-12(9)20/h2-7,20H,8H2,1H3 |
| InChIKey | VJDDXLFENKEEFH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|