C19H16BrNO7S — CID 5184889
methyl 5-[[5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 5184889) has the molecular formula C19H16BrNO7S and a molecular weight of 482.31 g/mol. Its IUPAC name is methyl 5-[[5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 5184889 |
| Molecular Formula | C19H16BrNO7S |
| Molecular Weight | 482.31 g/mol |
| Exact Mass | 480.98 |
| IUPAC Name | methyl 5-[[5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | CCOc1cc(C=C2SC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)c(Br)cc1O |
| InChI | InChI=1S/C19H16BrNO7S/c1-3-27-15-6-10(12(20)8-13(15)22)7-16-17(23)21(19(25)29-16)9-11-4-5-14(28-11)18(24)26-2/h4-8,22H,3,9H2,1-2H3 |
| InChIKey | UFCJQKGIEGJZED-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|