C19H16ClNO6S — CID 6045951
methyl 5-[[(5Z)-5-[(5-chloro-2-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 6045951) has the molecular formula C19H16ClNO6S and a molecular weight of 421.86 g/mol. Its IUPAC name is methyl 5-[[(5Z)-5-[(5-chloro-2-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(5Z)-5-[(5-chloro-2-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 6045951 |
| Molecular Formula | C19H16ClNO6S |
| Molecular Weight | 421.86 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | methyl 5-[[(5Z)-5-[(5-chloro-2-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | CCOc1ccc(Cl)cc1/C=C1\SC(=O)N(Cc2ccc(C(=O)OC)o2)C1=O |
| InChI | InChI=1S/C19H16ClNO6S/c1-3-26-14-6-4-12(20)8-11(14)9-16-17(22)21(19(24)28-16)10-13-5-7-15(27-13)18(23)25-2/h4-9H,3,10H2,1-2H3/b16-9- |
| InChIKey | FLTABGQCYZKKDM-SXGWCWSVSA-N |
| XLogP | 4.35 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.86 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|