C18H13Cl2NO6S — CID 124548799
methyl 5-[[(5E)-5-[(3,5-dichloro-4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 124548799) has the molecular formula C18H13Cl2NO6S and a molecular weight of 442.28 g/mol. Its IUPAC name is methyl 5-[[(5E)-5-[(3,5-dichloro-4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(5E)-5-[(3,5-dichloro-4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 124548799 |
| Molecular Formula | C18H13Cl2NO6S |
| Molecular Weight | 442.28 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | methyl 5-[[(5E)-5-[(3,5-dichloro-4-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)S/C(=C/c3cc(Cl)c(OC)c(Cl)c3)C2=O)o1 |
| InChI | InChI=1S/C18H13Cl2NO6S/c1-25-15-11(19)5-9(6-12(15)20)7-14-16(22)21(18(24)28-14)8-10-3-4-13(27-10)17(23)26-2/h3-7H,8H2,1-2H3/b14-7+ |
| InChIKey | CHDNNQUAEGRNET-VGOFMYFVSA-N |
| XLogP | 4.62 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.28 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|