C24H16Br3NO6S — CID 126392013
methyl 5-[[(5E)-5-[[3,5-dibromo-4-[(4-bromophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 126392013) has the molecular formula C24H16Br3NO6S and a molecular weight of 686.17 g/mol. Its IUPAC name is methyl 5-[[(5E)-5-[[3,5-dibromo-4-[(4-bromophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(5E)-5-[[3,5-dibromo-4-[(4-bromophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126392013 |
| Molecular Formula | C24H16Br3NO6S |
| Molecular Weight | 686.17 g/mol |
| Exact Mass | 682.82 |
| IUPAC Name | methyl 5-[[(5E)-5-[[3,5-dibromo-4-[(4-bromophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)S/C(=C/c3cc(Br)c(OCc4ccc(Br)cc4)c(Br)c3)C2=O)o1 |
| InChI | InChI=1S/C24H16Br3NO6S/c1-32-23(30)19-7-6-16(34-19)11-28-22(29)20(35-24(28)31)10-14-8-17(26)21(18(27)9-14)33-12-13-2-4-15(25)5-3-13/h2-10H,11-12H2,1H3/b20-10+ |
| InChIKey | BDVAXHKUCRLNRY-KEBDBYFISA-N |
| XLogP | 7.17 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.17 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|