C19H13Br2NO8S — CID 126389532
2-[2,6-dibromo-4-[(E)-[3-[(5-methoxycarbonylfuran-2-yl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126389532) has the molecular formula C19H13Br2NO8S and a molecular weight of 575.19 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(E)-[3-[(5-methoxycarbonylfuran-2-yl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-[(E)-[3-[(5-methoxycarbonylfuran-2-yl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126389532 |
| Molecular Formula | C19H13Br2NO8S |
| Molecular Weight | 575.19 g/mol |
| Exact Mass | 572.87 |
| IUPAC Name | 2-[2,6-dibromo-4-[(E)-[3-[(5-methoxycarbonylfuran-2-yl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | COC(=O)c1ccc(CN2C(=O)S/C(=C/c3cc(Br)c(OCC(=O)O)c(Br)c3)C2=O)o1 |
| InChI | InChI=1S/C19H13Br2NO8S/c1-28-18(26)13-3-2-10(30-13)7-22-17(25)14(31-19(22)27)6-9-4-11(20)16(12(21)5-9)29-8-15(23)24/h2-6H,7-8H2,1H3,(H,23,24)/b14-6+ |
| InChIKey | HOJCKZNCWHBDDE-MKMNVTDBSA-N |
| XLogP | 4.29 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.19 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|