C15H10BrNO5S2 — CID 6173332
methyl 5-[[(5E)-5-[(4-bromothiophen-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 6173332) has the molecular formula C15H10BrNO5S2 and a molecular weight of 428.29 g/mol. Its IUPAC name is methyl 5-[[(5E)-5-[(4-bromothiophen-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(5E)-5-[(4-bromothiophen-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 6173332 |
| Molecular Formula | C15H10BrNO5S2 |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 426.92 |
| IUPAC Name | methyl 5-[[(5E)-5-[(4-bromothiophen-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)S/C(=C/c3cc(Br)cs3)C2=O)o1 |
| InChI | InChI=1S/C15H10BrNO5S2/c1-21-14(19)11-3-2-9(22-11)6-17-13(18)12(24-15(17)20)5-10-4-8(16)7-23-10/h2-5,7H,6H2,1H3/b12-5+ |
| InChIKey | HVTACNPVAUDQCD-LFYBBSHMSA-N |
| XLogP | 4.13 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|