C20H19NO8S — CID 5133266
methyl 5-[[2,4-dioxo-5-[(2,4,6-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 5133266) has the molecular formula C20H19NO8S and a molecular weight of 433.44 g/mol. Its IUPAC name is methyl 5-[[2,4-dioxo-5-[(2,4,6-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[2,4-dioxo-5-[(2,4,6-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 5133266 |
| Molecular Formula | C20H19NO8S |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | methyl 5-[[2,4-dioxo-5-[(2,4,6-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)SC(=Cc3c(OC)cc(OC)cc3OC)C2=O)o1 |
| InChI | InChI=1S/C20H19NO8S/c1-25-12-7-15(26-2)13(16(8-12)27-3)9-17-18(22)21(20(24)30-17)10-11-5-6-14(29-11)19(23)28-4/h5-9H,10H2,1-4H3 |
| InChIKey | SLYFJDPKEHTVPB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 104.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|