C23H17NO5S — CID 4275248
methyl 5-[[2,4-dioxo-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 4275248) has the molecular formula C23H17NO5S and a molecular weight of 419.46 g/mol. Its IUPAC name is methyl 5-[[2,4-dioxo-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[2,4-dioxo-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 4275248 |
| Molecular Formula | C23H17NO5S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | methyl 5-[[2,4-dioxo-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)SC(=Cc3ccc(-c4ccccc4)cc3)C2=O)o1 |
| InChI | InChI=1S/C23H17NO5S/c1-28-22(26)19-12-11-18(29-19)14-24-21(25)20(30-23(24)27)13-15-7-9-17(10-8-15)16-5-3-2-4-6-16/h2-13H,14H2,1H3 |
| InChIKey | XTOVAJQXTAVXTM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|