C18H12F3NO5S — CID 6386687
methyl 5-[[(5E)-2,4-dioxo-5-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 6386687) has the molecular formula C18H12F3NO5S and a molecular weight of 411.36 g/mol. Its IUPAC name is methyl 5-[[(5E)-2,4-dioxo-5-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(5E)-2,4-dioxo-5-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 6386687 |
| Molecular Formula | C18H12F3NO5S |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | methyl 5-[[(5E)-2,4-dioxo-5-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)S/C(=C/c3ccc(C(F)(F)F)cc3)C2=O)o1 |
| InChI | InChI=1S/C18H12F3NO5S/c1-26-16(24)13-7-6-12(27-13)9-22-15(23)14(28-17(22)25)8-10-2-4-11(5-3-10)18(19,20)21/h2-8H,9H2,1H3/b14-8+ |
| InChIKey | RJWKPGQILBIVSE-RIYZIHGNSA-N |
| XLogP | 4.32 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|