C21H20ClNO6S — CID 4587456
methyl 5-[[5-[(4-butan-2-yloxy-3-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 4587456) has the molecular formula C21H20ClNO6S and a molecular weight of 449.91 g/mol. Its IUPAC name is methyl 5-[[5-[(4-butan-2-yloxy-3-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[5-[(4-butan-2-yloxy-3-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 4587456 |
| Molecular Formula | C21H20ClNO6S |
| Molecular Weight | 449.91 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | methyl 5-[[5-[(4-butan-2-yloxy-3-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | CCC(C)Oc1ccc(C=C2SC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)cc1Cl |
| InChI | InChI=1S/C21H20ClNO6S/c1-4-12(2)28-16-7-5-13(9-15(16)22)10-18-19(24)23(21(26)30-18)11-14-6-8-17(29-14)20(25)27-3/h5-10,12H,4,11H2,1-3H3 |
| InChIKey | OHDIZGOMQCQSBQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.91 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|