C19H22ClNO5S — CID 126104062
propan-2-yl 2-[(5E)-5-[[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126104062) has the molecular formula C19H22ClNO5S and a molecular weight of 411.91 g/mol. Its IUPAC name is propan-2-yl 2-[(5E)-5-[[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | propan-2-yl 2-[(5E)-5-[[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126104062 |
| Molecular Formula | C19H22ClNO5S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | propan-2-yl 2-[(5E)-5-[[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC[C@H](C)Oc1ccc(/C=C2/SC(=O)N(CC(=O)OC(C)C)C2=O)cc1Cl |
| InChI | InChI=1S/C19H22ClNO5S/c1-5-12(4)26-15-7-6-13(8-14(15)20)9-16-18(23)21(19(24)27-16)10-17(22)25-11(2)3/h6-9,11-12H,5,10H2,1-4H3/b16-9+/t12-/m0/s1 |
| InChIKey | OJIKQNHMQLBQRN-RGZVIEDOSA-N |
| XLogP | 4.51 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|