C19H21F2NO6S — CID 126363953
[(2R)-butan-2-yl] 2-[(5Z)-5-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126363953) has the molecular formula C19H21F2NO6S and a molecular weight of 429.44 g/mol. Its IUPAC name is [(2R)-butan-2-yl] 2-[(5Z)-5-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | [(2R)-butan-2-yl] 2-[(5Z)-5-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126363953 |
| Molecular Formula | C19H21F2NO6S |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | [(2R)-butan-2-yl] 2-[(5Z)-5-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CC(=O)O[C@H](C)CC)C2=O)ccc1OC(F)F |
| InChI | InChI=1S/C19H21F2NO6S/c1-4-11(3)27-16(23)10-22-17(24)15(29-19(22)25)9-12-6-7-13(28-18(20)21)14(8-12)26-5-2/h6-9,11,18H,4-5,10H2,1-3H3/b15-9-/t11-/m1/s1 |
| InChIKey | LTBNHWARYVAJQI-PDICVPPASA-N |
| XLogP | 4.06 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|