C22H29NO6S — CID 126214274
[(2R)-butan-2-yl] 2-[(5Z)-5-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126214274) has the molecular formula C22H29NO6S and a molecular weight of 435.54 g/mol. Its IUPAC name is [(2R)-butan-2-yl] 2-[(5Z)-5-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | [(2R)-butan-2-yl] 2-[(5Z)-5-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126214274 |
| Molecular Formula | C22H29NO6S |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | [(2R)-butan-2-yl] 2-[(5Z)-5-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOc1cc(/C=C2\SC(=O)N(CC(=O)O[C@H](C)CC)C2=O)ccc1OCC(C)C |
| InChI | InChI=1S/C22H29NO6S/c1-6-15(5)29-20(24)12-23-21(25)19(30-22(23)26)11-16-8-9-17(28-13-14(3)4)18(10-16)27-7-2/h8-11,14-15H,6-7,12-13H2,1-5H3/b19-11-/t15-/m1/s1 |
| InChIKey | ANQUWKOPLZUYPJ-MXDDHBLUSA-N |
| XLogP | 4.50 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|