C21H29NO4S — CID 126209905
(5Z)-5-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]-3-pentyl-1,3-thiazolidine-2,4-dione (PubChem CID 126209905) has the molecular formula C21H29NO4S and a molecular weight of 391.53 g/mol. Its IUPAC name is (5Z)-5-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]-3-pentyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]-3-pentyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126209905 |
| Molecular Formula | C21H29NO4S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | (5Z)-5-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]-3-pentyl-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCCN1C(=O)S/C(=C\c2ccc(OCC(C)C)c(OCC)c2)C1=O |
| InChI | InChI=1S/C21H29NO4S/c1-5-7-8-11-22-20(23)19(27-21(22)24)13-16-9-10-17(26-14-15(3)4)18(12-16)25-6-2/h9-10,12-13,15H,5-8,11,14H2,1-4H3/b19-13- |
| InChIKey | YFOJQKBYZQIWQK-UYRXBGFRSA-N |
| XLogP | 5.35 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|