C25H19ClN2O7S — CID 126392488
methyl 5-[[(5E)-5-[[4-(2-anilino-2-oxoethoxy)-3-chlorophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 126392488) has the molecular formula C25H19ClN2O7S and a molecular weight of 526.95 g/mol. Its IUPAC name is methyl 5-[[(5E)-5-[[4-(2-anilino-2-oxoethoxy)-3-chlorophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(5E)-5-[[4-(2-anilino-2-oxoethoxy)-3-chlorophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126392488 |
| Molecular Formula | C25H19ClN2O7S |
| Molecular Weight | 526.95 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | methyl 5-[[(5E)-5-[[4-(2-anilino-2-oxoethoxy)-3-chlorophenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)S/C(=C/c3ccc(OCC(=O)Nc4ccccc4)c(Cl)c3)C2=O)o1 |
| InChI | InChI=1S/C25H19ClN2O7S/c1-33-24(31)20-10-8-17(35-20)13-28-23(30)21(36-25(28)32)12-15-7-9-19(18(26)11-15)34-14-22(29)27-16-5-3-2-4-6-16/h2-12H,13-14H2,1H3,(H,27,29)/b21-12+ |
| InChIKey | YULCELGTGIWHDT-CIAFOILYSA-N |
| XLogP | 4.97 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.95 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|