C25H21NO7S — CID 3347422
methyl 5-[[4-[(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate (PubChem CID 3347422) has the molecular formula C25H21NO7S and a molecular weight of 479.51 g/mol. Its IUPAC name is methyl 5-[[4-[(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 3347422 |
| Molecular Formula | C25H21NO7S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | methyl 5-[[4-[(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COc2ccc(C=C3SC(=O)N(Cc4ccccc4)C3=O)cc2OC)o1 |
| InChI | InChI=1S/C25H21NO7S/c1-30-21-12-17(8-10-19(21)32-15-18-9-11-20(33-18)24(28)31-2)13-22-23(27)26(25(29)34-22)14-16-6-4-3-5-7-16/h3-13H,14-15H2,1-2H3 |
| InChIKey | GHDKXWSLBNPCLX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|